C17H16BrNO3S — CID 4195676
3-(4-bromophenyl)-2-(2,3-dimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 4195676) has the molecular formula C17H16BrNO3S and a molecular weight of 394.29 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-(2,3-dimethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-bromophenyl)-2-(2,3-dimethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4195676 |
| Molecular Formula | C17H16BrNO3S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 3-(4-bromophenyl)-2-(2,3-dimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(C2SCC(=O)N2c2ccc(Br)cc2)c1OC |
| InChI | InChI=1S/C17H16BrNO3S/c1-21-14-5-3-4-13(16(14)22-2)17-19(15(20)10-23-17)12-8-6-11(18)7-9-12/h3-9,17H,10H2,1-2H3 |
| InChIKey | PHFJRGXOKTWSNI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |