C15H24N2O3 — CID 4196548
5-acetyl-3-methyl-1-octan-2-ylpyrimidine-2,4-dione (PubChem CID 4196548) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-acetyl-3-methyl-1-octan-2-ylpyrimidine-2,4-dione.
| Compound Name | 5-acetyl-3-methyl-1-octan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4196548 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5-acetyl-3-methyl-1-octan-2-ylpyrimidine-2,4-dione |
| SMILES | CCCCCCC(C)n1cc(C(C)=O)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H24N2O3/c1-5-6-7-8-9-11(2)17-10-13(12(3)18)14(19)16(4)15(17)20/h10-11H,5-9H2,1-4H3 |
| InChIKey | VFAPIYZWVJSKHO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|