C13H11ClN3S+ — CID 4196774
2-[(4-chlorophenyl)sulfanylmethyl]-1H-imidazo[1,2-a]pyrimidin-4-ium (PubChem CID 4196774) has the molecular formula C13H11ClN3S+ and a molecular weight of 276.77 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfanylmethyl]-1H-imidazo[1,2-a]pyrimidin-4-ium.
| Compound Name | 2-[(4-chlorophenyl)sulfanylmethyl]-1H-imidazo[1,2-a]pyrimidin-4-ium |
|---|---|
| PubChem CID | 4196774 |
| Molecular Formula | C13H11ClN3S+ |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfanylmethyl]-1H-imidazo[1,2-a]pyrimidin-4-ium |
| SMILES | Clc1ccc(SCc2c[n+]3cccnc3[nH]2)cc1 |
| InChI | InChI=1S/C13H10ClN3S/c14-10-2-4-12(5-3-10)18-9-11-8-17-7-1-6-15-13(17)16-11/h1-8H,9H2/p+1 |
| InChIKey | CZXPVQYPVHIIPS-UHFFFAOYSA-O |
| XLogP | 3.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|