About 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol
6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (PubChem CID 4197136) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
Molecular Properties
| Compound Name | 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| PubChem CID | 4197136 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol |
| SMILES | NC1C=C(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C7H13NO4/c8-4-1-3(2-9)5(10)7(12)6(4)11/h1,4-7,9-12H,2,8H2 |
| InChIKey | XPHOBMULWMGEBA-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol?
The IUPAC name of 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol (CID 4197136) is 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol.
What is the SMILES notation for 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol?
The canonical SMILES for 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol is NC1C=C(CO)C(O)C(O)C1O.
What is the InChIKey of 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol?
The InChIKey is XPHOBMULWMGEBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c8-4-1-3(2-9)5(10)7(12)6(4)11/h1,4-7,9-12H,2,8H2.
What are the key properties of 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol?
6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol has a molecular weight of 175.18 g/mol, XLogP of -2.67, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-4-(hydroxymethyl)cyclohex-4-ene-1,2,3-triol is sourced from PubChem (CID 4197136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).