C21H17N3O4S — CID 4197160
[4-[[[2-(3-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 4197160) has the molecular formula C21H17N3O4S and a molecular weight of 407.45 g/mol. Its IUPAC name is [4-[[[2-(3-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[[[2-(3-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4197160 |
| Molecular Formula | C21H17N3O4S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [4-[[[2-(3-methylanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | Cc1cccc(NC(=O)C(=O)NN=Cc2ccc(OC(=O)c3cccs3)cc2)c1 |
| InChI | InChI=1S/C21H17N3O4S/c1-14-4-2-5-16(12-14)23-19(25)20(26)24-22-13-15-7-9-17(10-8-15)28-21(27)18-6-3-11-29-18/h2-13H,1H3,(H,23,25)(H,24,26) |
| InChIKey | MQVTYAKYKJCVLY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|