About [4-hydroxy-3,5-di(propan-2-yl)anilino]urea
[4-hydroxy-3,5-di(propan-2-yl)anilino]urea (PubChem CID 4197582) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is [4-hydroxy-3,5-di(propan-2-yl)anilino]urea.
Molecular Properties
| Compound Name | [4-hydroxy-3,5-di(propan-2-yl)anilino]urea |
| PubChem CID | 4197582 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | [4-hydroxy-3,5-di(propan-2-yl)anilino]urea |
| SMILES | CC(C)c1cc(NNC(N)=O)cc(C(C)C)c1O |
| InChI | InChI=1S/C13H21N3O2/c1-7(2)10-5-9(15-16-13(14)18)6-11(8(3)4)12(10)17/h5-8,15,17H,1-4H3,(H3,14,16,18) |
| InChIKey | TWQJKXWRJMJAMW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-hydroxy-3,5-di(propan-2-yl)anilino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-hydroxy-3,5-di(propan-2-yl)anilino]urea?
The IUPAC name of [4-hydroxy-3,5-di(propan-2-yl)anilino]urea (CID 4197582) is [4-hydroxy-3,5-di(propan-2-yl)anilino]urea.
What is the SMILES notation for [4-hydroxy-3,5-di(propan-2-yl)anilino]urea?
The canonical SMILES for [4-hydroxy-3,5-di(propan-2-yl)anilino]urea is CC(C)c1cc(NNC(N)=O)cc(C(C)C)c1O.
What is the InChIKey of [4-hydroxy-3,5-di(propan-2-yl)anilino]urea?
The InChIKey is TWQJKXWRJMJAMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-7(2)10-5-9(15-16-13(14)18)6-11(8(3)4)12(10)17/h5-8,15,17H,1-4H3,(H3,14,16,18).
What are the key properties of [4-hydroxy-3,5-di(propan-2-yl)anilino]urea?
[4-hydroxy-3,5-di(propan-2-yl)anilino]urea has a molecular weight of 251.33 g/mol, XLogP of 2.63, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-hydroxy-3,5-di(propan-2-yl)anilino]urea is sourced from PubChem (CID 4197582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).