C25H19N5 — CID 4197826
5-amino-7-(9-methylcarbazol-3-yl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile (PubChem CID 4197826) has the molecular formula C25H19N5 and a molecular weight of 389.46 g/mol. Its IUPAC name is 5-amino-7-(9-methylcarbazol-3-yl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile.
| Compound Name | 5-amino-7-(9-methylcarbazol-3-yl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile |
|---|---|
| PubChem CID | 4197826 |
| Molecular Formula | C25H19N5 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 5-amino-7-(9-methylcarbazol-3-yl)-1,2,7,7a-tetrahydroindene-4,6,6-tricarbonitrile |
| SMILES | Cn1c2ccccc2c2cc(C3C4CCC=C4C(C#N)=C(N)C3(C#N)C#N)ccc21 |
| InChI | InChI=1S/C25H19N5/c1-30-21-8-3-2-5-17(21)19-11-15(9-10-22(19)30)23-18-7-4-6-16(18)20(12-26)24(29)25(23,13-27)14-28/h2-3,5-6,8-11,18,23H,4,7,29H2,1H3 |
| InChIKey | SUXMTDFHBNMSGN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|