7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid

C9H8O3S — CID 4198218

IUPAC7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid
SMILESO=C1CC(C(=O)O)Cc2ccsc21
InChIInChI=1S/C9H8O3S/c10-7-4-6(9(11)12)3-5-1-2-13-8(5)7/h1-2,6H,3-4H2,(H,11,12)
InChIKeyBKUGICAJDKYYRA-UHFFFAOYSA-N
MW196.23 g/mol
LogP1.58
Rot. Bonds1

About 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid

7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid (PubChem CID 4198218) has the molecular formula C9H8O3S and a molecular weight of 196.23 g/mol. Its IUPAC name is 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid.

Molecular Properties

Compound Name7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid
PubChem CID4198218
Molecular FormulaC9H8O3S
Molecular Weight196.23 g/mol
Exact Mass196.02
IUPAC Name7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid
SMILESO=C1CC(C(=O)O)Cc2ccsc21
InChIInChI=1S/C9H8O3S/c10-7-4-6(9(11)12)3-5-1-2-13-8(5)7/h1-2,6H,3-4H2,(H,11,12)
InChIKeyBKUGICAJDKYYRA-UHFFFAOYSA-N
XLogP1.58
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.23
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid?
The IUPAC name of 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid (CID 4198218) is 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid.
What is the SMILES notation for 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid?
The canonical SMILES for 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid is O=C1CC(C(=O)O)Cc2ccsc21.
What is the InChIKey of 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid?
The InChIKey is BKUGICAJDKYYRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S/c10-7-4-6(9(11)12)3-5-1-2-13-8(5)7/h1-2,6H,3-4H2,(H,11,12).
What are the key properties of 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid?
7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid has a molecular weight of 196.23 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid is sourced from PubChem (CID 4198218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).