About 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid
7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid (PubChem CID 4198218) has the molecular formula C9H8O3S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid.
Molecular Properties
| Compound Name | 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid |
| PubChem CID | 4198218 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)Cc2ccsc21 |
| InChI | InChI=1S/C9H8O3S/c10-7-4-6(9(11)12)3-5-1-2-13-8(5)7/h1-2,6H,3-4H2,(H,11,12) |
| InChIKey | BKUGICAJDKYYRA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid?
The IUPAC name of 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid (CID 4198218) is 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid.
What is the SMILES notation for 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid?
The canonical SMILES for 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid is O=C1CC(C(=O)O)Cc2ccsc21.
What is the InChIKey of 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid?
The InChIKey is BKUGICAJDKYYRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S/c10-7-4-6(9(11)12)3-5-1-2-13-8(5)7/h1-2,6H,3-4H2,(H,11,12).
What are the key properties of 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid?
7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid has a molecular weight of 196.23 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxo-5,6-dihydro-4H-1-benzothiophene-5-carboxylic acid is sourced from PubChem (CID 4198218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).