About 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid
3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid (PubChem CID 4198464) has the molecular formula C18H17N3O3S
and a molecular weight of 355.42 g/mol. Its IUPAC name is 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid |
| PubChem CID | 4198464 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid |
| SMILES | Cc1nc(SCC(=O)Nc2cccc(C(=O)O)c2)c(C#N)c(C)c1C |
| InChI | InChI=1S/C18H17N3O3S/c1-10-11(2)15(8-19)17(20-12(10)3)25-9-16(22)21-14-6-4-5-13(7-14)18(23)24/h4-7H,9H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | XCDMVVTWHHYHBQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid?
The IUPAC name of 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid (CID 4198464) is 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid.
What is the SMILES notation for 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid?
The canonical SMILES for 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid is Cc1nc(SCC(=O)Nc2cccc(C(=O)O)c2)c(C#N)c(C)c1C.
What is the InChIKey of 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid?
The InChIKey is XCDMVVTWHHYHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O3S/c1-10-11(2)15(8-19)17(20-12(10)3)25-9-16(22)21-14-6-4-5-13(7-14)18(23)24/h4-7H,9H2,1-3H3,(H,21,22)(H,23,24).
What are the key properties of 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid?
3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid has a molecular weight of 355.42 g/mol, XLogP of 3.31, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-[(3-cyano-4,5,6-trimethyl-2-pyridinyl)sulfanyl]acetyl]amino]benzoic acid is sourced from PubChem (CID 4198464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).