C23H26N4O2S — CID 4198842
3-butyl-1-(furan-2-ylmethyl)-1-[2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)ethyl]urea (PubChem CID 4198842) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-butyl-1-(furan-2-ylmethyl)-1-[2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)ethyl]urea.
| Compound Name | 3-butyl-1-(furan-2-ylmethyl)-1-[2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 4198842 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-butyl-1-(furan-2-ylmethyl)-1-[2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)ethyl]urea |
| SMILES | CCCCNC(=O)N(CCc1csc2nc(-c3ccccc3)cn12)Cc1ccco1 |
| InChI | InChI=1S/C23H26N4O2S/c1-2-3-12-24-22(28)26(15-20-10-7-14-29-20)13-11-19-17-30-23-25-21(16-27(19)23)18-8-5-4-6-9-18/h4-10,14,16-17H,2-3,11-13,15H2,1H3,(H,24,28) |
| InChIKey | HOFQOBSXWSVCCM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|