C16H8BrF17 — CID 4198863
1-bromo-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)benzene (PubChem CID 4198863) has the molecular formula C16H8BrF17 and a molecular weight of 603.11 g/mol. Its IUPAC name is 1-bromo-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)benzene.
| Compound Name | 1-bromo-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)benzene |
|---|---|
| PubChem CID | 4198863 |
| Molecular Formula | C16H8BrF17 |
| Molecular Weight | 603.11 g/mol |
| Exact Mass | 601.95 |
| IUPAC Name | 1-bromo-3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCc1cccc(Br)c1 |
| InChI | InChI=1S/C16H8BrF17/c17-8-3-1-2-7(6-8)4-5-9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)14(28,29)15(30,31)16(32,33)34/h1-3,6H,4-5H2 |
| InChIKey | AFJHWCKFHITISQ-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.11 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|