About N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide
N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide (PubChem CID 4199029) has the molecular formula C9H17NO6
and a molecular weight of 235.24 g/mol. Its IUPAC name is N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide.
Molecular Properties
| Compound Name | N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide |
| PubChem CID | 4199029 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide |
| SMILES | CCC(=O)NC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C9H17NO6/c1-2-5(12)10-9-8(15)7(14)6(13)4(3-11)16-9/h4,6-9,11,13-15H,2-3H2,1H3,(H,10,12) |
| InChIKey | VZKGVACXVPMLDD-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide?
The IUPAC name of N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide (CID 4199029) is N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide.
What is the SMILES notation for N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide?
The canonical SMILES for N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide is CCC(=O)NC1OC(CO)C(O)C(O)C1O.
What is the InChIKey of N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide?
The InChIKey is VZKGVACXVPMLDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO6/c1-2-5(12)10-9-8(15)7(14)6(13)4(3-11)16-9/h4,6-9,11,13-15H,2-3H2,1H3,(H,10,12).
What are the key properties of N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide?
N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide has a molecular weight of 235.24 g/mol, XLogP of -2.69, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]propanamide is sourced from PubChem (CID 4199029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).