About N-cyclopropyl-3,4-difluorobenzenesulfonamide
N-cyclopropyl-3,4-difluorobenzenesulfonamide (PubChem CID 4199260) has the molecular formula C9H9F2NO2S
and a molecular weight of 233.24 g/mol. Its IUPAC name is N-cyclopropyl-3,4-difluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-cyclopropyl-3,4-difluorobenzenesulfonamide |
| PubChem CID | 4199260 |
| Molecular Formula | C9H9F2NO2S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | N-cyclopropyl-3,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H9F2NO2S/c10-8-4-3-7(5-9(8)11)15(13,14)12-6-1-2-6/h3-6,12H,1-2H2 |
| InChIKey | NLFFYOJXFSKEDN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopropyl-3,4-difluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3,4-difluorobenzenesulfonamide?
The IUPAC name of N-cyclopropyl-3,4-difluorobenzenesulfonamide (CID 4199260) is N-cyclopropyl-3,4-difluorobenzenesulfonamide.
What is the SMILES notation for N-cyclopropyl-3,4-difluorobenzenesulfonamide?
The canonical SMILES for N-cyclopropyl-3,4-difluorobenzenesulfonamide is O=S(=O)(NC1CC1)c1ccc(F)c(F)c1.
What is the InChIKey of N-cyclopropyl-3,4-difluorobenzenesulfonamide?
The InChIKey is NLFFYOJXFSKEDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO2S/c10-8-4-3-7(5-9(8)11)15(13,14)12-6-1-2-6/h3-6,12H,1-2H2.
What are the key properties of N-cyclopropyl-3,4-difluorobenzenesulfonamide?
N-cyclopropyl-3,4-difluorobenzenesulfonamide has a molecular weight of 233.24 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3,4-difluorobenzenesulfonamide is sourced from PubChem (CID 4199260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).