C34H23N3O7 — CID 4199335
2-[[3,5-bis[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methyl]isoindole-1,3-dione (PubChem CID 4199335) has the molecular formula C34H23N3O7 and a molecular weight of 585.57 g/mol. Its IUPAC name is 2-[[3,5-bis[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3,5-bis[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4199335 |
| Molecular Formula | C34H23N3O7 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 2-[[3,5-bis[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methyl]isoindole-1,3-dione |
| SMILES | COc1c(CN2C(=O)c3ccccc3C2=O)cc(CN2C(=O)c3ccccc3C2=O)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C34H23N3O7/c1-44-28-20(17-36-31(40)24-10-4-5-11-25(24)32(36)41)14-19(16-35-29(38)22-8-2-3-9-23(22)30(35)39)15-21(28)18-37-33(42)26-12-6-7-13-27(26)34(37)43/h2-15H,16-18H2,1H3 |
| InChIKey | HZOMHKDWEIDQEO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 121.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|