About 4-chloro-2-(1,2-oxazol-5-yl)phenol
4-chloro-2-(1,2-oxazol-5-yl)phenol (PubChem CID 4199500) has the molecular formula C9H6ClNO2
and a molecular weight of 195.61 g/mol. Its IUPAC name is 4-chloro-2-(1,2-oxazol-5-yl)phenol.
Molecular Properties
| Compound Name | 4-chloro-2-(1,2-oxazol-5-yl)phenol |
| PubChem CID | 4199500 |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.61 g/mol |
| Exact Mass | 195.01 |
| IUPAC Name | 4-chloro-2-(1,2-oxazol-5-yl)phenol |
| SMILES | Oc1ccc(Cl)cc1-c1ccno1 |
| InChI | InChI=1S/C9H6ClNO2/c10-6-1-2-8(12)7(5-6)9-3-4-11-13-9/h1-5,12H |
| InChIKey | AAJXJLYUWKMQNO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-(1,2-oxazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(1,2-oxazol-5-yl)phenol?
The IUPAC name of 4-chloro-2-(1,2-oxazol-5-yl)phenol (CID 4199500) is 4-chloro-2-(1,2-oxazol-5-yl)phenol.
What is the SMILES notation for 4-chloro-2-(1,2-oxazol-5-yl)phenol?
The canonical SMILES for 4-chloro-2-(1,2-oxazol-5-yl)phenol is Oc1ccc(Cl)cc1-c1ccno1.
What is the InChIKey of 4-chloro-2-(1,2-oxazol-5-yl)phenol?
The InChIKey is AAJXJLYUWKMQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2/c10-6-1-2-8(12)7(5-6)9-3-4-11-13-9/h1-5,12H.
What are the key properties of 4-chloro-2-(1,2-oxazol-5-yl)phenol?
4-chloro-2-(1,2-oxazol-5-yl)phenol has a molecular weight of 195.61 g/mol, XLogP of 2.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(1,2-oxazol-5-yl)phenol is sourced from PubChem (CID 4199500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).