C24H23ClN2O6S2 — CID 4199742
[1-chloro-3-oxo-4-(2-oxo-1,3-benzothiazol-3-yl)-2-(propoxymethyl)butan-2-yl] 2-(2-oxo-1,3-benzothiazol-3-yl)acetate (PubChem CID 4199742) has the molecular formula C24H23ClN2O6S2 and a molecular weight of 535.04 g/mol. Its IUPAC name is [1-chloro-3-oxo-4-(2-oxo-1,3-benzothiazol-3-yl)-2-(propoxymethyl)butan-2-yl] 2-(2-oxo-1,3-benzothiazol-3-yl)acetate.
| Compound Name | [1-chloro-3-oxo-4-(2-oxo-1,3-benzothiazol-3-yl)-2-(propoxymethyl)butan-2-yl] 2-(2-oxo-1,3-benzothiazol-3-yl)acetate |
|---|---|
| PubChem CID | 4199742 |
| Molecular Formula | C24H23ClN2O6S2 |
| Molecular Weight | 535.04 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | [1-chloro-3-oxo-4-(2-oxo-1,3-benzothiazol-3-yl)-2-(propoxymethyl)butan-2-yl] 2-(2-oxo-1,3-benzothiazol-3-yl)acetate |
| SMILES | CCCOCC(CCl)(OC(=O)Cn1c(=O)sc2ccccc21)C(=O)Cn1c(=O)sc2ccccc21 |
| InChI | InChI=1S/C24H23ClN2O6S2/c1-2-11-32-15-24(14-25,20(28)12-26-16-7-3-5-9-18(16)34-22(26)30)33-21(29)13-27-17-8-4-6-10-19(17)35-23(27)31/h3-10H,2,11-15H2,1H3 |
| InChIKey | DYUSTWSZAKRLLB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.04 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|