C23H23BrN4O3S — CID 4200669
2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[[4-(dimethylamino)phenyl]methylideneamino]acetamide (PubChem CID 4200669) has the molecular formula C23H23BrN4O3S and a molecular weight of 515.43 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[[4-(dimethylamino)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[[4-(dimethylamino)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4200669 |
| Molecular Formula | C23H23BrN4O3S |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-bromoanilino]-N-[[4-(dimethylamino)phenyl]methylideneamino]acetamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)CN(c2ccc(Br)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23BrN4O3S/c1-27(2)20-12-8-18(9-13-20)16-25-26-23(29)17-28(21-14-10-19(24)11-15-21)32(30,31)22-6-4-3-5-7-22/h3-16H,17H2,1-2H3,(H,26,29) |
| InChIKey | BWDUQGPJEKOVLJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|