About 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole
3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole (PubChem CID 4200841) has the molecular formula C24H18N2O2
and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole.
Molecular Properties
| Compound Name | 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole |
| PubChem CID | 4200841 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole |
| SMILES | c1ccc2c(C(c3ccc4c(c3)OCO4)c3c[nH]c4ccccc34)c[nH]c2c1 |
| InChI | InChI=1S/C24H18N2O2/c1-3-7-20-16(5-1)18(12-25-20)24(15-9-10-22-23(11-15)28-14-27-22)19-13-26-21-8-4-2-6-17(19)21/h1-13,24-26H,14H2 |
| InChIKey | WIBZMRRXTPDBLD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 50.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole?
The IUPAC name of 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole (CID 4200841) is 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole.
What is the SMILES notation for 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole?
The canonical SMILES for 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole is c1ccc2c(C(c3ccc4c(c3)OCO4)c3c[nH]c4ccccc34)c[nH]c2c1.
What is the InChIKey of 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole?
The InChIKey is WIBZMRRXTPDBLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O2/c1-3-7-20-16(5-1)18(12-25-20)24(15-9-10-22-23(11-15)28-14-27-22)19-13-26-21-8-4-2-6-17(19)21/h1-13,24-26H,14H2.
What are the key properties of 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole?
3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole has a molecular weight of 366.42 g/mol, XLogP of 5.56, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-1H-indole is sourced from PubChem (CID 4200841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).