C17H16N2O2S2 — CID 42008522
4-ethoxy-N-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 42008522) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-ethoxy-N-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-ethoxy-N-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 42008522 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-ethoxy-N-[4-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)Nc2nc(-c3ccc(C)s3)cs2)cc1 |
| InChI | InChI=1S/C17H16N2O2S2/c1-3-21-13-7-5-12(6-8-13)16(20)19-17-18-14(10-22-17)15-9-4-11(2)23-15/h4-10H,3H2,1-2H3,(H,18,19,20) |
| InChIKey | YWBSCJGUAYUTNI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |