About 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one
2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one (PubChem CID 4201247) has the molecular formula C26H18N2OS
and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one.
Molecular Properties
| Compound Name | 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one |
| PubChem CID | 4201247 |
| Molecular Formula | C26H18N2OS |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one |
| SMILES | O=c1c(=CC=Cc2ccccc2)sc2nc(-c3ccccc3)c(-c3ccccc3)n12 |
| InChI | InChI=1S/C26H18N2OS/c29-25-22(18-10-13-19-11-4-1-5-12-19)30-26-27-23(20-14-6-2-7-15-20)24(28(25)26)21-16-8-3-9-17-21/h1-18H |
| InChIKey | FBEXTNHMPLDAPP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one?
The IUPAC name of 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one (CID 4201247) is 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one.
What is the SMILES notation for 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one?
The canonical SMILES for 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one is O=c1c(=CC=Cc2ccccc2)sc2nc(-c3ccccc3)c(-c3ccccc3)n12.
What is the InChIKey of 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one?
The InChIKey is FBEXTNHMPLDAPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18N2OS/c29-25-22(18-10-13-19-11-4-1-5-12-19)30-26-27-23(20-14-6-2-7-15-20)24(28(25)26)21-16-8-3-9-17-21/h1-18H.
What are the key properties of 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one?
2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one has a molecular weight of 406.51 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cinnamylidene-5,6-diphenylimidazo[2,1-b][1,3]thiazol-3-one is sourced from PubChem (CID 4201247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).