C21H17N3O3S2 — CID 4201723
4-methoxy-N-[5-[(1-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 4201723) has the molecular formula C21H17N3O3S2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 4-methoxy-N-[5-[(1-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-methoxy-N-[5-[(1-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 4201723 |
| Molecular Formula | C21H17N3O3S2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 4-methoxy-N-[5-[(1-methylindol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)NN2C(=O)C(=Cc3cn(C)c4ccccc34)SC2=S)cc1 |
| InChI | InChI=1S/C21H17N3O3S2/c1-23-12-14(16-5-3-4-6-17(16)23)11-18-20(26)24(21(28)29-18)22-19(25)13-7-9-15(27-2)10-8-13/h3-12H,1-2H3,(H,22,25) |
| InChIKey | BFMGZIGAVTUHOJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|