About 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine
4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 4201906) has the molecular formula C13H21N5
and a molecular weight of 247.35 g/mol. Its IUPAC name is 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine |
| PubChem CID | 4201906 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCN1CCCCC1c1nc(N)nc2c1CCN2 |
| InChI | InChI=1S/C13H21N5/c1-2-18-8-4-3-5-10(18)11-9-6-7-15-12(9)17-13(14)16-11/h10H,2-8H2,1H3,(H3,14,15,16,17) |
| InChIKey | BBWMKFWSFCPGNO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine?
The IUPAC name of 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine (CID 4201906) is 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine is CCN1CCCCC1c1nc(N)nc2c1CCN2.
What is the InChIKey of 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine?
The InChIKey is BBWMKFWSFCPGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N5/c1-2-18-8-4-3-5-10(18)11-9-6-7-15-12(9)17-13(14)16-11/h10H,2-8H2,1H3,(H3,14,15,16,17).
What are the key properties of 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine?
4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine has a molecular weight of 247.35 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethylpiperidin-2-yl)-6,7-dihydro-5H-pyrrolo[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 4201906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).