About [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate
[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate (PubChem CID 4202315) has the molecular formula C18H25ClO2
and a molecular weight of 308.85 g/mol. Its IUPAC name is [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate.
Molecular Properties
| Compound Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate |
| PubChem CID | 4202315 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate |
| SMILES | CC1CCC(C(C)(C)c2ccccc2)C(OC(=O)CCl)C1 |
| InChI | InChI=1S/C18H25ClO2/c1-13-9-10-15(16(11-13)21-17(20)12-19)18(2,3)14-7-5-4-6-8-14/h4-8,13,15-16H,9-12H2,1-3H3 |
| InChIKey | GYWWQECFQIGECM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate?
The IUPAC name of [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate (CID 4202315) is [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate.
What is the SMILES notation for [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate?
The canonical SMILES for [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate is CC1CCC(C(C)(C)c2ccccc2)C(OC(=O)CCl)C1.
What is the InChIKey of [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate?
The InChIKey is GYWWQECFQIGECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25ClO2/c1-13-9-10-15(16(11-13)21-17(20)12-19)18(2,3)14-7-5-4-6-8-14/h4-8,13,15-16H,9-12H2,1-3H3.
What are the key properties of [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate?
[5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate has a molecular weight of 308.85 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] 2-chloroacetate is sourced from PubChem (CID 4202315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).