C18H18N6O — CID 42024085
(3-phenyl-1H-pyrazol-5-yl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone (PubChem CID 42024085) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is (3-phenyl-1H-pyrazol-5-yl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (3-phenyl-1H-pyrazol-5-yl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 42024085 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (3-phenyl-1H-pyrazol-5-yl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)n[nH]1)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C18H18N6O/c25-18(16-12-15(21-22-16)14-4-2-1-3-5-14)24-10-8-23(9-11-24)17-13-19-6-7-20-17/h1-7,12-13H,8-11H2,(H,21,22) |
| InChIKey | XOVPLUHLHWTHRF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |