C17H18N2O4S — CID 42027103
2-(2-acetylanilino)-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 42027103) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-(2-acetylanilino)-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-acetylanilino)-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 42027103 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-(2-acetylanilino)-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | CC(=O)c1ccccc1NCC(=O)Nc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-12(20)15-5-3-4-6-16(15)18-11-17(21)19-13-7-9-14(10-8-13)24(2,22)23/h3-10,18H,11H2,1-2H3,(H,19,21) |
| InChIKey | CRGSLLFWFJIMJO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |