C21H21N3O5S — CID 4202953
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 4202953) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 4202953 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H21N3O5S/c25-18(22-17-11-12-30(28,29)14-17)13-24-19(26)21(23-20(24)27,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17H,11-14H2,(H,22,25)(H,23,27) |
| InChIKey | JUGOROJVPNQRLJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|