About 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole
2-cyclohexyl-5-ethyl-1,3,4-oxadiazole (PubChem CID 4204011) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole |
| PubChem CID | 4204011 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole |
| SMILES | CCc1nnc(C2CCCCC2)o1 |
| InChI | InChI=1S/C10H16N2O/c1-2-9-11-12-10(13-9)8-6-4-3-5-7-8/h8H,2-7H2,1H3 |
| InChIKey | PJCCKXYKZZVZLX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole?
The IUPAC name of 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole (CID 4204011) is 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole.
What is the SMILES notation for 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole?
The canonical SMILES for 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole is CCc1nnc(C2CCCCC2)o1.
What is the InChIKey of 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole?
The InChIKey is PJCCKXYKZZVZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-2-9-11-12-10(13-9)8-6-4-3-5-7-8/h8H,2-7H2,1H3.
What are the key properties of 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole?
2-cyclohexyl-5-ethyl-1,3,4-oxadiazole has a molecular weight of 180.25 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-5-ethyl-1,3,4-oxadiazole is sourced from PubChem (CID 4204011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).