About [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate
[4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate (PubChem CID 4204166) has the molecular formula C26H17ClN2O4S3
and a molecular weight of 553.09 g/mol. Its IUPAC name is [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate.
Molecular Properties
| Compound Name | [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate |
| PubChem CID | 4204166 |
| Molecular Formula | C26H17ClN2O4S3 |
| Molecular Weight | 553.09 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2csc(=NS(=O)(=O)c3ccc(Cl)s3)n2-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H17ClN2O4S3/c27-23-15-16-24(35-23)36(31,32)28-26-29(20-9-5-2-6-10-20)22(17-34-26)18-11-13-21(14-12-18)33-25(30)19-7-3-1-4-8-19/h1-17H |
| InChIKey | AZGAYJUJKHVNNV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 553.09 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate?
The IUPAC name of [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate (CID 4204166) is [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate.
What is the SMILES notation for [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate?
The canonical SMILES for [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate is O=C(Oc1ccc(-c2csc(=NS(=O)(=O)c3ccc(Cl)s3)n2-c2ccccc2)cc1)c1ccccc1.
What is the InChIKey of [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate?
The InChIKey is AZGAYJUJKHVNNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17ClN2O4S3/c27-23-15-16-24(35-23)36(31,32)28-26-29(20-9-5-2-6-10-20)22(17-34-26)18-11-13-21(14-12-18)33-25(30)19-7-3-1-4-8-19/h1-17H.
What are the key properties of [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate?
[4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate has a molecular weight of 553.09 g/mol, XLogP of 6.43, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-phenyl-1,3-thiazol-4-yl]phenyl] benzoate is sourced from PubChem (CID 4204166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).