C22H18N2O3 — CID 4204273
12-(3,4-dihydroxyphenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one (PubChem CID 4204273) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 12-(3,4-dihydroxyphenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one.
| Compound Name | 12-(3,4-dihydroxyphenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one |
|---|---|
| PubChem CID | 4204273 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 12-(3,4-dihydroxyphenyl)-8,9,10,12-tetrahydro-7H-benzo[b][4,7]phenanthrolin-11-one |
| SMILES | O=C1CCCC2=C1C(c1ccc(O)c(O)c1)c1c(ccc3ncccc13)N2 |
| InChI | InChI=1S/C22H18N2O3/c25-17-9-6-12(11-19(17)27)20-21-13-3-2-10-23-14(13)7-8-16(21)24-15-4-1-5-18(26)22(15)20/h2-3,6-11,20,24-25,27H,1,4-5H2 |
| InChIKey | IWLIWTHFSYYKFK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|