About bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol
bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol (PubChem CID 4204275) has the molecular formula C16H11Cl2NOS
and a molecular weight of 336.24 g/mol. Its IUPAC name is bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol |
| PubChem CID | 4204275 |
| Molecular Formula | C16H11Cl2NOS |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol |
| SMILES | OC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccns1 |
| InChI | InChI=1S/C16H11Cl2NOS/c17-13-5-1-11(2-6-13)16(20,15-9-10-19-21-15)12-3-7-14(18)8-4-12/h1-10,20H |
| InChIKey | ODIXSVXECWIULF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol?
The IUPAC name of bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol (CID 4204275) is bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol.
What is the SMILES notation for bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol?
The canonical SMILES for bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol is OC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccns1.
What is the InChIKey of bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol?
The InChIKey is ODIXSVXECWIULF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2NOS/c17-13-5-1-11(2-6-13)16(20,15-9-10-19-21-15)12-3-7-14(18)8-4-12/h1-10,20H.
What are the key properties of bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol?
bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol has a molecular weight of 336.24 g/mol, XLogP of 4.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-chlorophenyl)-(1,2-thiazol-5-yl)methanol is sourced from PubChem (CID 4204275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).