About 5-phenyl-1,3-oxazole-4-carbonitrile
5-phenyl-1,3-oxazole-4-carbonitrile (PubChem CID 4204481) has the molecular formula C10H6N2O
and a molecular weight of 170.17 g/mol. Its IUPAC name is 5-phenyl-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-phenyl-1,3-oxazole-4-carbonitrile |
| PubChem CID | 4204481 |
| Molecular Formula | C10H6N2O |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 5-phenyl-1,3-oxazole-4-carbonitrile |
| SMILES | N#Cc1ncoc1-c1ccccc1 |
| InChI | InChI=1S/C10H6N2O/c11-6-9-10(13-7-12-9)8-4-2-1-3-5-8/h1-5,7H |
| InChIKey | RVYLXUPJRHATPI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenyl-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-1,3-oxazole-4-carbonitrile?
The IUPAC name of 5-phenyl-1,3-oxazole-4-carbonitrile (CID 4204481) is 5-phenyl-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 5-phenyl-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 5-phenyl-1,3-oxazole-4-carbonitrile is N#Cc1ncoc1-c1ccccc1.
What is the InChIKey of 5-phenyl-1,3-oxazole-4-carbonitrile?
The InChIKey is RVYLXUPJRHATPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O/c11-6-9-10(13-7-12-9)8-4-2-1-3-5-8/h1-5,7H.
What are the key properties of 5-phenyl-1,3-oxazole-4-carbonitrile?
5-phenyl-1,3-oxazole-4-carbonitrile has a molecular weight of 170.17 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 4204481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).