C10H10FN3O — CID 42046788
(1R)-1-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]ethanamine (PubChem CID 42046788) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is (1R)-1-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]ethanamine.
| Compound Name | (1R)-1-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 42046788 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (1R)-1-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]ethanamine |
| SMILES | C[C@@H](N)c1nnc(-c2cccc(F)c2)o1 |
| InChI | InChI=1S/C10H10FN3O/c1-6(12)9-13-14-10(15-9)7-3-2-4-8(11)5-7/h2-6H,12H2,1H3/t6-/m1/s1 |
| InChIKey | BZHZJLJFGVGERU-ZCFIWIBFSA-N |
| XLogP | 1.90 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |