C15H14Cl4O4 — CID 4205160
1,8,9,10-tetrachloro-11,11-diethoxytricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 4205160) has the molecular formula C15H14Cl4O4 and a molecular weight of 400.09 g/mol. Its IUPAC name is 1,8,9,10-tetrachloro-11,11-diethoxytricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | 1,8,9,10-tetrachloro-11,11-diethoxytricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 4205160 |
| Molecular Formula | C15H14Cl4O4 |
| Molecular Weight | 400.09 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | 1,8,9,10-tetrachloro-11,11-diethoxytricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | CCOC1(OCC)C2(Cl)C(Cl)=C(Cl)C1(Cl)C1C(=O)C=CC(=O)C12 |
| InChI | InChI=1S/C15H14Cl4O4/c1-3-22-15(23-4-2)13(18)9-7(20)5-6-8(21)10(9)14(15,19)12(17)11(13)16/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | RFSQLNWNPPSREQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.09 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|