C15H18N2 — CID 4205291
3-phenyl-5,5a,6,7,8,9-hexahydro-4H-1,2-benzodiazepine (PubChem CID 4205291) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-phenyl-5,5a,6,7,8,9-hexahydro-4H-1,2-benzodiazepine.
| Compound Name | 3-phenyl-5,5a,6,7,8,9-hexahydro-4H-1,2-benzodiazepine |
|---|---|
| PubChem CID | 4205291 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 3-phenyl-5,5a,6,7,8,9-hexahydro-4H-1,2-benzodiazepine |
| SMILES | c1ccc(C2=NN=C3CCCCC3CC2)cc1 |
| InChI | InChI=1S/C15H18N2/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-17-15/h1-3,6-7,13H,4-5,8-11H2 |
| InChIKey | HVOAGICUTRDASX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |