About 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea
1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea (PubChem CID 4205496) has the molecular formula C16H26N2OS
and a molecular weight of 294.46 g/mol. Its IUPAC name is 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea |
| PubChem CID | 4205496 |
| Molecular Formula | C16H26N2OS |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea |
| SMILES | CCCCSCCCNC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H26N2OS/c1-4-5-10-20-11-6-9-17-16(19)18-15-8-7-13(2)14(3)12-15/h7-8,12H,4-6,9-11H2,1-3H3,(H2,17,18,19) |
| InChIKey | YFBGPBRSDDKTQE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea?
The IUPAC name of 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea (CID 4205496) is 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea.
What is the SMILES notation for 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea?
The canonical SMILES for 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea is CCCCSCCCNC(=O)Nc1ccc(C)c(C)c1.
What is the InChIKey of 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea?
The InChIKey is YFBGPBRSDDKTQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2OS/c1-4-5-10-20-11-6-9-17-16(19)18-15-8-7-13(2)14(3)12-15/h7-8,12H,4-6,9-11H2,1-3H3,(H2,17,18,19).
What are the key properties of 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea?
1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea has a molecular weight of 294.46 g/mol, XLogP of 4.35, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-butylsulfanylpropyl)-3-(3,4-dimethylphenyl)urea is sourced from PubChem (CID 4205496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).