C23H21N5O2S2 — CID 42056600
2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]acetamide (PubChem CID 42056600) has the molecular formula C23H21N5O2S2 and a molecular weight of 463.59 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 42056600 |
| Molecular Formula | C23H21N5O2S2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[4-(pyridin-3-ylmethylsulfanyl)phenyl]acetamide |
| SMILES | COc1ccc(-c2n[nH]c(=S)n2CC(=O)Nc2ccc(SCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C23H21N5O2S2/c1-30-19-8-4-17(5-9-19)22-26-27-23(31)28(22)14-21(29)25-18-6-10-20(11-7-18)32-15-16-3-2-12-24-13-16/h2-13H,14-15H2,1H3,(H,25,29)(H,27,31) |
| InChIKey | YHXQNMGJWKRSMD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|