C16H14N2O2S — CID 4205942
2-[4-(dimethylamino)phenyl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 4205942) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[4-(dimethylamino)phenyl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 4205942 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CN(C)c1ccc(-c2nc3ccc(C(=O)O)cc3s2)cc1 |
| InChI | InChI=1S/C16H14N2O2S/c1-18(2)12-6-3-10(4-7-12)15-17-13-8-5-11(16(19)20)9-14(13)21-15/h3-9H,1-2H3,(H,19,20) |
| InChIKey | XZFAXTQPYYOHJN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|