About N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide
N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide (PubChem CID 42063375) has the molecular formula C12H13N7O2S
and a molecular weight of 319.35 g/mol. Its IUPAC name is N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide |
| PubChem CID | 42063375 |
| Molecular Formula | C12H13N7O2S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(CNc2ccc3nnnn3n2)c1 |
| InChI | InChI=1S/C12H13N7O2S/c1-22(20,21)16-10-4-2-3-9(7-10)8-13-11-5-6-12-14-17-18-19(12)15-11/h2-7,16H,8H2,1H3,(H,13,15) |
| InChIKey | NNNMKYZLVUPXET-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide?
The IUPAC name of N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide (CID 42063375) is N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide?
The canonical SMILES for N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide is CS(=O)(=O)Nc1cccc(CNc2ccc3nnnn3n2)c1.
What is the InChIKey of N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide?
The InChIKey is NNNMKYZLVUPXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N7O2S/c1-22(20,21)16-10-4-2-3-9(7-10)8-13-11-5-6-12-14-17-18-19(12)15-11/h2-7,16H,8H2,1H3,(H,13,15).
What are the key properties of N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide?
N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide has a molecular weight of 319.35 g/mol, XLogP of 0.50, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(tetrazolo[1,5-b]pyridazin-6-ylamino)methyl]phenyl]methanesulfonamide is sourced from PubChem (CID 42063375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).