C19H18N4O3 — CID 42063924
ethyl 4-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]benzoate (PubChem CID 42063924) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is ethyl 4-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 42063924 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | ethyl 4-[[4-(1,2,4-triazol-1-ylmethyl)benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccc(Cn3cncn3)cc2)cc1 |
| InChI | InChI=1S/C19H18N4O3/c1-2-26-19(25)16-7-9-17(10-8-16)22-18(24)15-5-3-14(4-6-15)11-23-13-20-12-21-23/h3-10,12-13H,2,11H2,1H3,(H,22,24) |
| InChIKey | RZALMGSHFQIDDK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |