C23H31N3O7S — CID 4206454
(2,5-dioxopyrrolidin-1-yl) 1-[3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]piperidine-4-carboxylate (PubChem CID 4206454) has the molecular formula C23H31N3O7S and a molecular weight of 493.58 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1-[3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]piperidine-4-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1-[3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4206454 |
| Molecular Formula | C23H31N3O7S |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1-[3-methyl-2-[(4-methylphenyl)sulfonylamino]pentanoyl]piperidine-4-carboxylate |
| SMILES | CCC(C)C(NS(=O)(=O)c1ccc(C)cc1)C(=O)N1CCC(C(=O)ON2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C23H31N3O7S/c1-4-16(3)21(24-34(31,32)18-7-5-15(2)6-8-18)22(29)25-13-11-17(12-14-25)23(30)33-26-19(27)9-10-20(26)28/h5-8,16-17,21,24H,4,9-14H2,1-3H3 |
| InChIKey | UUQGQTRWRZDNKX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|