C15H25NO3S — CID 42065813
N-[(2R)-butan-2-yl]-5-tert-butyl-2-methoxybenzenesulfonamide (PubChem CID 42065813) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-5-tert-butyl-2-methoxybenzenesulfonamide.
| Compound Name | N-[(2R)-butan-2-yl]-5-tert-butyl-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 42065813 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[(2R)-butan-2-yl]-5-tert-butyl-2-methoxybenzenesulfonamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc(C(C)(C)C)ccc1OC |
| InChI | InChI=1S/C15H25NO3S/c1-7-11(2)16-20(17,18)14-10-12(15(3,4)5)8-9-13(14)19-6/h8-11,16H,7H2,1-6H3/t11-/m1/s1 |
| InChIKey | AHZIIJIKEVUOGC-LLVKDONJSA-N |
| XLogP | 3.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |