C25H16N2O3S — CID 42066206
(13S)-13-(4-methylphenyl)-14-(1,3-thiazol-2-yl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione (PubChem CID 42066206) has the molecular formula C25H16N2O3S and a molecular weight of 424.48 g/mol. Its IUPAC name is (13S)-13-(4-methylphenyl)-14-(1,3-thiazol-2-yl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione.
| Compound Name | (13S)-13-(4-methylphenyl)-14-(1,3-thiazol-2-yl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
|---|---|
| PubChem CID | 42066206 |
| Molecular Formula | C25H16N2O3S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (13S)-13-(4-methylphenyl)-14-(1,3-thiazol-2-yl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione |
| SMILES | Cc1ccc([C@H]2c3c(oc4c(ccc5ccccc54)c3=O)C(=O)N2c2nccs2)cc1 |
| InChI | InChI=1S/C25H16N2O3S/c1-14-6-8-16(9-7-14)20-19-21(28)18-11-10-15-4-2-3-5-17(15)22(18)30-23(19)24(29)27(20)25-26-12-13-31-25/h2-13,20H,1H3/t20-/m0/s1 |
| InChIKey | GSVHKBZSIFZMRH-FQEVSTJZSA-N |
| XLogP | 5.46 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|