C22H19NOP+ — CID 4206683
(2-methyl-1,3-oxazol-4-yl)-triphenylphosphanium (PubChem CID 4206683) has the molecular formula C22H19NOP+ and a molecular weight of 344.37 g/mol. Its IUPAC name is (2-methyl-1,3-oxazol-4-yl)-triphenylphosphanium.
| Compound Name | (2-methyl-1,3-oxazol-4-yl)-triphenylphosphanium |
|---|---|
| PubChem CID | 4206683 |
| Molecular Formula | C22H19NOP+ |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2-methyl-1,3-oxazol-4-yl)-triphenylphosphanium |
| SMILES | Cc1nc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)co1 |
| InChI | InChI=1S/C22H19NOP/c1-18-23-22(17-24-18)25(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-17H,1H3/q+1 |
| InChIKey | ZJVSKJUDAHFHAO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|