C22H15BrN4O6 — CID 42066966
(5S)-7-bromo-4-(2,4-dinitrobenzoyl)-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 42066966) has the molecular formula C22H15BrN4O6 and a molecular weight of 511.29 g/mol. Its IUPAC name is (5S)-7-bromo-4-(2,4-dinitrobenzoyl)-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | (5S)-7-bromo-4-(2,4-dinitrobenzoyl)-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 42066966 |
| Molecular Formula | C22H15BrN4O6 |
| Molecular Weight | 511.29 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | (5S)-7-bromo-4-(2,4-dinitrobenzoyl)-5-phenyl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN(C(=O)c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])[C@@H](c2ccccc2)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C22H15BrN4O6/c23-14-6-9-18-17(10-14)21(13-4-2-1-3-5-13)25(12-20(28)24-18)22(29)16-8-7-15(26(30)31)11-19(16)27(32)33/h1-11,21H,12H2,(H,24,28)/t21-/m0/s1 |
| InChIKey | YXVBVJAFHVWJFZ-NRFANRHFSA-N |
| XLogP | 4.45 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|