C8H4F9N3OS — CID 4207224
2,2,3,3,4,4,5,5,5-nonafluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)pentanamide (PubChem CID 4207224) has the molecular formula C8H4F9N3OS and a molecular weight of 361.19 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 4207224 |
| Molecular Formula | C8H4F9N3OS |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)pentanamide |
| SMILES | Cc1nnc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C8H4F9N3OS/c1-2-19-20-4(22-2)18-3(21)5(9,10)6(11,12)7(13,14)8(15,16)17/h1H3,(H,18,20,21) |
| InChIKey | JLJLAYBSMBACNH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|