C31H32N2O6S — CID 4207349
N-(4-ethoxyphenyl)-6,7-dimethoxy-1-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 4207349) has the molecular formula C31H32N2O6S and a molecular weight of 560.67 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-6,7-dimethoxy-1-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | N-(4-ethoxyphenyl)-6,7-dimethoxy-1-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 4207349 |
| Molecular Formula | C31H32N2O6S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | N-(4-ethoxyphenyl)-6,7-dimethoxy-1-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)N2CCc3cc(OC)c(OC)cc3C2COc2ccc3c(C)cc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C31H32N2O6S/c1-5-37-22-8-6-21(7-9-22)32-31(40)33-13-12-20-15-28(35-3)29(36-4)17-25(20)26(33)18-38-23-10-11-24-19(2)14-30(34)39-27(24)16-23/h6-11,14-17,26H,5,12-13,18H2,1-4H3,(H,32,40) |
| InChIKey | VXJZEXIJLKPQDR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 82.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|