C13H17NO — CID 42076609
(3,4-dimethylphenyl)-[(2R)-pyrrolidin-2-yl]methanone (PubChem CID 42076609) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-[(2R)-pyrrolidin-2-yl]methanone.
| Compound Name | (3,4-dimethylphenyl)-[(2R)-pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 42076609 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3,4-dimethylphenyl)-[(2R)-pyrrolidin-2-yl]methanone |
| SMILES | Cc1ccc(C(=O)[C@H]2CCCN2)cc1C |
| InChI | InChI=1S/C13H17NO/c1-9-5-6-11(8-10(9)2)13(15)12-4-3-7-14-12/h5-6,8,12,14H,3-4,7H2,1-2H3/t12-/m1/s1 |
| InChIKey | XJSJGDSMDXGGTN-GFCCVEGCSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |