About (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine
(2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine (PubChem CID 42079396) has the molecular formula C13H19ClN2
and a molecular weight of 238.76 g/mol. Its IUPAC name is (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine |
| PubChem CID | 42079396 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine |
| SMILES | Cc1c(Cl)cccc1N1[C@@H](C)CNC[C@@H]1C |
| InChI | InChI=1S/C13H19ClN2/c1-9-7-15-8-10(2)16(9)13-6-4-5-12(14)11(13)3/h4-6,9-10,15H,7-8H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | KPIUJOCQDXHOQX-UWVGGRQHSA-N |
| XLogP | 2.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine?
The IUPAC name of (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine (CID 42079396) is (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine.
What is the SMILES notation for (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine?
The canonical SMILES for (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine is Cc1c(Cl)cccc1N1[C@@H](C)CNC[C@@H]1C.
What is the InChIKey of (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine?
The InChIKey is KPIUJOCQDXHOQX-UWVGGRQHSA-N. The full InChI is InChI=1S/C13H19ClN2/c1-9-7-15-8-10(2)16(9)13-6-4-5-12(14)11(13)3/h4-6,9-10,15H,7-8H2,1-3H3/t9-,10-/m0/s1.
What are the key properties of (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine?
(2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine has a molecular weight of 238.76 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-1-(3-chloro-2-methylphenyl)-2,6-dimethylpiperazine is sourced from PubChem (CID 42079396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).