C16H14Cl3N3O5S — CID 42085510
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetate (PubChem CID 42085510) has the molecular formula C16H14Cl3N3O5S and a molecular weight of 466.73 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 42085510 |
| Molecular Formula | C16H14Cl3N3O5S |
| Molecular Weight | 466.73 g/mol |
| Exact Mass | 464.97 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 2-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]sulfanylacetate |
| SMILES | Cc1cc(NC(=O)CSCC(=O)OCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)no1 |
| InChI | InChI=1S/C16H14Cl3N3O5S/c1-8-2-13(22-27-8)21-15(24)6-28-7-16(25)26-5-14(23)20-12-4-10(18)9(17)3-11(12)19/h2-4H,5-7H2,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | CUVOFSZDVHAXGD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|