About dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate
dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate (PubChem CID 4208717) has the molecular formula C14H14N4O4S
and a molecular weight of 334.36 g/mol. Its IUPAC name is dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate |
| PubChem CID | 4208717 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=N/c2sc(N)nc2C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C14H14N4O4S/c1-7-11(23-14(15)16-7)18-17-10-5-8(12(19)21-2)4-9(6-10)13(20)22-3/h4-6H,1-3H3,(H2,15,16)/b18-17+ |
| InChIKey | CXJZFJNVSZSPIZ-ISLYRVAYSA-N |
| XLogP | 3.02 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate?
The IUPAC name of dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate (CID 4208717) is dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate?
The canonical SMILES for dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate is COC(=O)c1cc(/N=N/c2sc(N)nc2C)cc(C(=O)OC)c1.
What is the InChIKey of dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate?
The InChIKey is CXJZFJNVSZSPIZ-ISLYRVAYSA-N. The full InChI is InChI=1S/C14H14N4O4S/c1-7-11(23-14(15)16-7)18-17-10-5-8(12(19)21-2)4-9(6-10)13(20)22-3/h4-6H,1-3H3,(H2,15,16)/b18-17+.
What are the key properties of dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate?
dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate has a molecular weight of 334.36 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-[(2-amino-4-methyl-1,3-thiazol-5-yl)diazenyl]benzene-1,3-dicarboxylate is sourced from PubChem (CID 4208717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).